CymitQuimica logo

CAS 1018127-79-1

:

2-Amino-7-methoxy-4H-1,3-thiazino[5,6-c]quinolin-4-one

Description:
2-Amino-7-methoxy-4H-1,3-thiazino[5,6-c]quinolin-4-one is a heterocyclic compound characterized by its complex structure, which includes a quinoline core fused with a thiazine ring. This compound features an amino group and a methoxy group, which contribute to its chemical reactivity and potential biological activity. The presence of the thiazine moiety suggests that it may exhibit unique properties, such as antimicrobial or antitumor activities, making it of interest in medicinal chemistry. The molecular structure allows for various interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may affect its application in drug development or as a research tool. Overall, 2-Amino-7-methoxy-4H-1,3-thiazino[5,6-c]quinolin-4-one represents a class of compounds that may hold promise for further investigation in the fields of organic synthesis and pharmacology.
Formula:C12H9N3O2S
InChI:InChI=1S/C12H9N3O2S/c1-17-8-4-2-3-6-9(8)14-5-7-10(6)18-12(13)15-11(7)16/h2-5H,1H3,(H2,13,15,16)
InChI key:InChIKey=QELQUYGOHDTGKL-UHFFFAOYSA-N
SMILES:O(C)C=1C=2C(=C3C(=CN2)C(=O)N=C(N)S3)C=CC1
Synonyms:
  • 4H-1,3-Thiazino[5,6-c]quinolin-4-one, 2-amino-7-methoxy-
  • 2-Amino-7-methoxy-4H-1,3-thiazino[5,6-c]quinolin-4-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.