CAS 1018128-03-4

3-Ethyl 6-methyl 4-chloro-3,6-quinolinedicarboxylate

Description:

3-Ethyl 6-methyl 4-chloro-3,6-quinolinedicarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features two carboxylate groups, which contribute to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of an ethyl group and a methyl group on the quinoline ring enhances its lipophilicity, potentially influencing its biological activity and solubility properties. The chlorine substituent at the 4-position can also affect the compound's reactivity and interaction with biological targets. Generally, compounds like this may exhibit various pharmacological activities, making them of interest in drug development. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many synthetic organic compounds, safety data and handling precautions should be considered due to potential toxicity or reactivity.

Formula: C₁₄H₁₂ClNO₄

InChI: InChI=1S/C14H12ClNO4/c1-3-20-14(18)10-7-16-11-5-4-8(13(17)19-2)6-9(11)12(10)15/h4-7H,3H2,1-2H3

InChI key: InChIKey=LEZCXIVGIHYLBB-UHFFFAOYSA-N

SMILES: ClC=1C2=C(N=CC1C(OCC)=O)C=CC(C(OC)=O)=C2

Synonyms:

• 3,6-Quinolinedicarboxylic acid, 4-chloro-, 3-ethyl 6-methyl ester
• 3-Ethyl 6-methyl 4-chloro-3,6-quinolinedicarboxylate

3-Ethyl 6-Methyl 4-Chloro-3,6-Quinolinedicarboxylate

CAS: 1018128-03-4

Formula: C₁₄H₁₂ClNO₄

Purity: 98%

Molecular weight: 293.7024

Ref: IN-DA00H9MW