CAS 1018142-65-8

1-[2-(Cyclopentylamino)-2-oxoethyl]-3-cyclopropyl-6-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

1-[2-(Cyclopentylamino)-2-oxoethyl]-3-cyclopropyl-6-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core, a carboxylic acid functional group, and various substituents such as cyclopentyl and cyclopropyl groups. This compound is typically studied for its potential biological activities, particularly in medicinal chemistry, where it may exhibit properties relevant to pharmacology. The presence of the pyrazole ring suggests possible interactions with biological targets, making it a candidate for further research in drug development. Its molecular structure indicates that it may possess specific stereochemical configurations, influencing its reactivity and interaction with biological systems. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, which are essential factors in its application and study. Overall, this compound represents a class of heterocyclic compounds that are of interest in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₈H₂₂N₄O₃

InChI: InChI=1S/C18H22N4O3/c1-10-8-13(18(24)25)15-16(11-6-7-11)21-22(17(15)19-10)9-14(23)20-12-4-2-3-5-12/h8,11-12H,2-7,9H2,1H3,(H,20,23)(H,24,25)

InChI key: InChIKey=XCRLHJMAJVLTCJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(=NN(CC(NC3CCCC3)=O)C2=NC(C)=C1)C4CC4

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 1-[2-(cyclopentylamino)-2-oxoethyl]-3-cyclopropyl-6-methyl-
• 1-[2-(Cyclopentylamino)-2-oxoethyl]-3-cyclopropyl-6-methyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid