CymitQuimica logo

CAS 1018142-68-1

:

2,3-Dihydro-1-(2-methoxyethyl)-6-methyl-2-thioxopyrido[2,3-d]pyrimidin-4(1H)-one

Description:
2,3-Dihydro-1-(2-methoxyethyl)-6-methyl-2-thioxopyrido[2,3-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its complex structure, which includes a pyrimidine ring fused with a pyridine moiety. This compound features a thioxo group, contributing to its potential reactivity and biological activity. The presence of a methoxyethyl substituent enhances its solubility and may influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The molecular structure suggests that it may exhibit various interactions with biological targets, making it a candidate for further research in areas such as anti-inflammatory or antimicrobial activity. Its CAS number, 1018142-68-1, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in scientific literature. Overall, this compound exemplifies the diversity and complexity found in organic chemistry, particularly within the realm of heterocyclic compounds.
Formula:C11H13N3O2S
InChI:InChI=1S/C11H13N3O2S/c1-7-5-8-9(12-6-7)14(3-4-16-2)11(17)13-10(8)15/h5-6H,3-4H2,1-2H3,(H,13,15,17)
InChI key:InChIKey=ZYYAPQKZDKGDEE-UHFFFAOYSA-N
SMILES:C(COC)N1C=2C(C(=O)NC1=S)=CC(C)=CN2
Synonyms:
  • Pyrido[2,3-d]pyrimidin-4(1H)-one, 2,3-dihydro-1-(2-methoxyethyl)-6-methyl-2-thioxo-
  • 2,3-Dihydro-1-(2-methoxyethyl)-6-methyl-2-thioxopyrido[2,3-d]pyrimidin-4(1H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.