CAS 1018142-71-6

3-Cyclopropyl-4-(difluoromethyl)-6,7-dihydro-6-oxo-1H-pyrazolo[3,4-b]pyridine-1-acetic acid

Description:

3-Cyclopropyl-4-(difluoromethyl)-6,7-dihydro-6-oxo-1H-pyrazolo[3,4-b]pyridine-1-acetic acid is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrazolo and pyridine moiety. This compound features a cyclopropyl group and a difluoromethyl substituent, contributing to its potential biological activity and chemical reactivity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The oxo group enhances the compound's reactivity, potentially allowing for further derivatization. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's CAS number, 1018142-71-6, serves as a unique identifier for regulatory and research purposes, facilitating its study in various chemical and biological contexts. Overall, this compound's distinctive features make it a subject of interest in both synthetic and applied chemistry.

Formula: C₁₂H₁₁F₂N₃O₃

InChI: InChI=1S/C12H11F2N3O3/c13-11(14)6-3-7(18)15-12-9(6)10(5-1-2-5)16-17(12)4-8(19)20/h3,5,11H,1-2,4H2,(H,15,18)(H,19,20)

InChI key: InChIKey=IWZYWROOFNUFAQ-UHFFFAOYSA-N

SMILES: C(F)(F)C=1C=2C(=NN(CC(O)=O)C2NC(=O)C1)C3CC3

Synonyms:

• 3-Cyclopropyl-4-(difluoromethyl)-6,7-dihydro-6-oxo-1H-pyrazolo[3,4-b]pyridine-1-acetic acid
• 1H-Pyrazolo[3,4-b]pyridine-1-acetic acid, 3-cyclopropyl-4-(difluoromethyl)-6,7-dihydro-6-oxo-

2-[3-Cyclopropyl-4-(difluoromethyl)-6-oxo-1H,6H,7H-pyrazolo[3,4-b]pyridin-1-yl]acetic acid

CAS: 1018142-71-6

Versatile small molecule scaffold

Formula: C₁₂H₁₁F₂N₃O₃

Purity: Min. 95%

Molecular weight: 283.23 g/mol

Ref: 3D-TQB14271