CymitQuimica logo

CAS 1018142-92-1

:

7-Chloro-2-(4-methylphenyl)oxazolo[5,4-d]pyrimidine

Description:
7-Chloro-2-(4-methylphenyl)oxazolo[5,4-d]pyrimidine is a heterocyclic compound characterized by its complex structure, which includes both oxazole and pyrimidine rings. This compound features a chlorine atom at the 7-position and a para-methylphenyl group at the 2-position of the oxazole ring, contributing to its unique chemical properties. It is typically classified as a pharmaceutical intermediate or a potential bioactive molecule, often investigated for its biological activities, including anti-inflammatory or anticancer properties. The presence of the chlorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the methyl group on the phenyl ring may affect the compound's electronic properties and steric hindrance, which can be crucial for its reactivity and binding affinity in biological systems. As with many heterocycles, the stability and solubility of this compound can vary based on environmental conditions, making it of interest in both synthetic and medicinal chemistry.
Formula:C12H8ClN3O
InChI:InChI=1S/C12H8ClN3O/c1-7-2-4-8(5-3-7)11-16-9-10(13)14-6-15-12(9)17-11/h2-6H,1H3
InChI key:InChIKey=VSDJHDJTXBOETC-UHFFFAOYSA-N
SMILES:ClC1=C2N=C(OC2=NC=N1)C3=CC=C(C)C=C3
Synonyms:
  • 7-Chloro-2-(4-methylphenyl)oxazolo[5,4-d]pyrimidine
  • 2-(4-Methylphenyl)-7-chloro[1,3]oxazolo[5,4-d]pyrimidine
  • Oxazolo[5,4-d]pyrimidine, 7-chloro-2-(4-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.