CAS 101819-99-2: Phenol, 6-amino-2,4-dichloro-3-ethyl-, hydrochloride (1:1)
Description:Phenol, 6-amino-2,4-dichloro-3-ethyl-, hydrochloride (1:1), with CAS number 101819-99-2, is a chemical compound characterized by its phenolic structure, which includes an amino group and multiple chlorine substituents on the aromatic ring. This compound typically appears as a crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The dichloro substitutions enhance its reactivity and may influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The amino group can participate in hydrogen bonding, affecting its solubility and interaction with biological systems. As with many chlorinated compounds, it may exhibit toxicity and environmental persistence, necessitating careful handling and disposal. Its specific applications and effects would depend on its chemical behavior, which can be influenced by the presence of the ethyl group and the overall molecular structure. Safety data sheets should be consulted for detailed handling and safety information.
Formula:C8H9Cl2NO·ClH
InChI:InChI=1S/C8H9Cl2NO.ClH/c1-2-4-5(9)3-6(11)8(12)7(4)10;/h3,12H,2,11H2,1H3;1H
InChI key:InChIKey=XZZITYVICUAZNB-UHFFFAOYSA-N
SMILES:Cl.ClC=1C=C(N)C(O)=C(Cl)C1CC
- Synonyms:
- 2,4-Dichloro-3-Ethyl-6-Amino Phenolhydrochloride
- 2-Amino-4,6-dichloro-5-ethylphenol hydrochloride
- 6-Amino-2,4-Dichloro-3-Ethylphenol Hydrochloride
- Phenol, 6-amino-2,4-dichloro-3-ethyl-, hydrochloride
- Phenol, 6-amino-2,4-dichloro-3-ethyl-, hydrochloride (1:1)
- 2,4-Dichloro-3-ethyl-6-aminophenol hydrochloride

6-Amino-2,4-dichloro-3-ethylphenol Hydrochloride
Ref: 3B-A2001
5g | 56.00 € | ||
25g | 159.00 € |

Phenol, 6-amino-2,4-dichloro-3-ethyl-, hydrochloride (1:1)
Ref: IN-DA0005MV
5g | 65.00 € | ||
25g | 119.00 € |

6-Amino-2,4-dichloro-3-ethylphenol hydrochloride
Ref: 10-F211786
5g | To inquire | ||
25g | To inquire |

6-Amino-2,4-dichloro-3-ethylphenol hydrochloride
Ref: 3D-FA155767
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information |