
CAS 101820-59-1
:8-Methylimidazo[1,2-a]pyridine-3-acetic acid
Description:
8-Methylimidazo[1,2-a]pyridine-3-acetic acid is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which includes a methyl group and an acetic acid functional group. This compound is notable for its potential biological activity, particularly in the context of food chemistry and toxicology, as it is a derivative of imidazoquinoline compounds that can be formed during the cooking of certain foods, especially those cooked at high temperatures. The presence of the methyl group at the 8-position and the acetic acid moiety at the 3-position contributes to its unique chemical properties and reactivity. It is of interest in research due to its implications in mutagenicity and carcinogenicity, as well as its role in the study of metabolic pathways. The compound is typically analyzed using techniques such as chromatography and mass spectrometry to understand its behavior in biological systems and its potential effects on human health.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-7-3-2-4-12-8(5-9(13)14)6-11-10(7)12/h2-4,6H,5H2,1H3,(H,13,14)
InChI key:InChIKey=UKRFQPYIYWEQKG-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1N2C(=NC1)C(C)=CC=C2
Synonyms:- 2-[8-Methylimidazo[1,2-a]pyridin-3-yl]acetic acid
- Imidazo[1,2-a]pyridine-3-acetic acid, 8-methyl-
- 8-Methylimidazo[1,2-a]pyridine-3-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.