
CAS 1018266-15-3
:1-(Cyclopentylamino)cyclopentanecarbonitrile
Description:
1-(Cyclopentylamino)cyclopentanecarbonitrile is a chemical compound characterized by its unique structure, which includes a cyclopentyl group and a carbonitrile functional group. This compound features a cyclopentanecarbonitrile backbone, where the carbonitrile (-C≡N) group is attached to a cyclopentane ring, and an amino group (-NH-) is linked to another cyclopentane ring. The presence of the amino group suggests potential for hydrogen bonding, which may influence its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the combination of the polar carbonitrile and the nonpolar cyclopentyl groups. Its molecular structure may confer specific biological activities, making it of interest in medicinal chemistry and drug development. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the cyclopentyl groups. Overall, 1-(Cyclopentylamino)cyclopentanecarbonitrile represents a class of compounds that may have applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C11H18N2
InChI:InChI=1S/C11H18N2/c12-9-11(7-3-4-8-11)13-10-5-1-2-6-10/h10,13H,1-8H2
InChI key:InChIKey=VNSBABMPJFUDNQ-UHFFFAOYSA-N
SMILES:N(C1(C#N)CCCC1)C2CCCC2
Synonyms:- 1-(Cyclopentylamino)cyclopentanecarbonitrile
- Cyclopentanecarbonitrile, 1-(cyclopentylamino)-
- 1-(Cyclopentylamino)cyclopentane-1-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(Cyclopentylamino)cyclopentane-1-carbonitrile
CAS:Controlled ProductFormula:C11H18N2Color and Shape:NeatMolecular weight:178.274
