
CAS 10183-49-0
:6,7-Dichloro-1,4,9,10-anthracenetetrol
Description:
6,7-Dichloro-1,4,9,10-anthracenetetrol is a polycyclic aromatic compound characterized by the presence of two chlorine atoms and four hydroxyl groups attached to an anthracene backbone. This compound exhibits a complex structure that contributes to its unique chemical properties, including potential applications in organic synthesis and materials science. The presence of hydroxyl groups suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. Additionally, the chlorinated nature of the compound may impart specific electronic properties, making it of interest in various chemical reactions. Its molecular structure allows for potential interactions with biological systems, which could be relevant in pharmacological studies. However, the toxicity and environmental impact of chlorinated compounds necessitate careful handling and assessment. Overall, 6,7-Dichloro-1,4,9,10-anthracenetetrol is a compound of interest in both academic research and industrial applications, warranting further investigation into its properties and potential uses.
Formula:C14H8Cl2O4
InChI:InChI=1S/C14H8Cl2O4/c15-7-3-5-6(4-8(7)16)14(20)12-10(18)2-1-9(17)11(12)13(5)19/h1-4,17-20H
InChI key:InChIKey=JKHMZJNNKYIWNR-UHFFFAOYSA-N
SMILES:OC=1C2=C(C(O)=C3C1C=C(Cl)C(Cl)=C3)C(O)=CC=C2O
Synonyms:- 6,7-Dichloroanthracene-1,4,9,10-tetrol
- 1,4,9,10-Anthracenetetrol, 6,7-dichloro-
- 6,7-Dichloro-1,4,9,10-anthracenetetrol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
