CAS 101831-71-4
:5-CYANOTRYPTAMINE HYDROCHLORIDE
Description:
5-Cyanotryptamine hydrochloride is a chemical compound that belongs to the class of tryptamines, which are characterized by their indole structure and amine functional group. This compound features a cyano group (-CN) attached to the 5-position of the tryptamine backbone, which can influence its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory settings. The presence of the cyano group may impart unique properties, potentially affecting its interaction with biological targets, such as receptors or enzymes. 5-Cyanotryptamine hydrochloride is of interest in pharmacological research, particularly in studies related to neurotransmitter systems and potential therapeutic applications. However, detailed studies on its pharmacodynamics, toxicity, and specific applications are necessary to fully understand its characteristics and potential uses in medicinal chemistry. As with all chemical substances, proper safety protocols should be followed when handling this compound.
Formula:C11H12ClN3
InChI:InChI=1/C11H11N3.ClH/c12-4-3-9-7-14-11-2-1-8(6-13)5-10(9)11;/h1-2,5,7,14H,3-4,12H2;1H
SMILES:c1cc2c(cc1C#N)c(CCN)c[nH]2.Cl
Synonyms:- 3-(2-Aminoethyl)-5-Cyanoindole Hydrochloride
- 3-(2-Aminoethyl)Indole-5-Carbonitrilehydrochloride
- 3-(2-Aminoethyl)-Indole-5-Carbonitrilhydrochloride
- 3-(2-aminoethyl)-1H-indole-5-carbonitrile hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Indole-5-carbonitrile, 3-(2-aminoethyl)-, hydrochloride (1:1)
CAS:Formula:C11H12ClN3Purity:95%Color and Shape:SolidMolecular weight:221.68613-(2-Aminoethyl)-1H-indole-5-carbonitrile hydrochloride
CAS:3-(2-Aminoethyl)-1H-indole-5-carbonitrile hydrochloridePurity:95%Molecular weight:221.69g/mol3-(2-Aminoethyl)-1H-indole-5-carbonitrile hydrochloride
CAS:Formula:C11H12ClN3Purity:95%Molecular weight:221.695-Cyanotryptamine hydrochloride
CAS:<p>5-Cyanotryptamine hydrochloride is a versatile building block and reagent for the synthesis of complex compounds. It is a fine chemical that is used in research and development, as well as in the production of speciality chemicals. This compound is used as a reaction component or scaffold in organic chemistry, due to its high quality and usefulness. 5-Cyanotryptamine hydrochloride has a CAS number of 101831-71-4 and has been assigned an EINECS number of 217-051-6.</p>Formula:C11H12ClN3Molecular weight:221.69 g/mol



