CAS 101832-90-0
:3-[(1-benzylpiperidin-4-yl)methyl]-1H-indole
Description:
3-[(1-benzylpiperidin-4-yl)methyl]-1H-indole, with the CAS number 101832-90-0, is a chemical compound that features a complex structure combining an indole moiety with a benzylpiperidine group. This compound is characterized by its potential pharmacological properties, often studied in the context of neuropharmacology due to its interactions with various neurotransmitter systems. The indole ring contributes to its aromatic characteristics, while the piperidine ring enhances its basicity and potential for forming hydrogen bonds. The presence of the benzyl group may influence its lipophilicity, affecting its ability to cross biological membranes. This compound may exhibit various biological activities, including effects on mood and cognition, making it of interest in medicinal chemistry. However, detailed studies are necessary to fully elucidate its mechanism of action, efficacy, and safety profile. As with many compounds in this category, its synthesis and characterization are crucial for understanding its potential applications in drug development.
Formula:C21H24N2
InChI:InChI=1/C21H24N2/c1-2-6-18(7-3-1)16-23-12-10-17(11-13-23)14-19-15-22-21-9-5-4-8-20(19)21/h1-9,15,17,22H,10-14,16H2
SMILES:c1ccc(cc1)CN1CCC(CC1)Cc1c[nH]c2ccccc12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

