CAS 10184-66-4
:Dimethyl P-(1-hydroxyethyl)phosphonate
Description:
Dimethyl P-(1-hydroxyethyl)phosphonate, with the CAS number 10184-66-4, is an organophosphorus compound characterized by its phosphonate functional group. This substance typically appears as a colorless to pale yellow liquid and is soluble in polar organic solvents. It features a phosphorus atom bonded to two methyl groups and a hydroxyethyl group, which contributes to its reactivity and potential applications. The presence of the hydroxyethyl moiety enhances its ability to participate in various chemical reactions, making it useful in the synthesis of other compounds. Dimethyl P-(1-hydroxyethyl)phosphonate is of interest in agricultural chemistry, particularly as a potential precursor for the development of herbicides or insecticides. Additionally, it may exhibit biological activity, which warrants careful handling due to potential toxicity. As with many organophosphorus compounds, it is essential to consider its environmental impact and regulatory status when evaluating its use in industrial or agricultural applications.
Formula:C4H11O4P
InChI:InChI=1S/C4H11O4P/c1-4(5)9(6,7-2)8-3/h4-5H,1-3H3
InChI key:InChIKey=KZHGNHTVCUWRKR-UHFFFAOYSA-N
SMILES:P(C(C)O)(OC)(OC)=O
Synonyms:- Phosphonic acid, (1-hydroxyethyl)-, dimethyl ester
- Dimethyl (1-hydroxyethyl)phosphonate
- Dimethyl P-(1-hydroxyethyl)phosphonate
- Phosphonic acid, P-(1-hydroxyethyl)-, dimethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
