CAS 1018443-34-9

3-(1-Azetidinyl)pyrrolidine

Description:

3-(1-Azetidinyl)pyrrolidine is a chemical compound characterized by its unique bicyclic structure, which includes a pyrrolidine ring and an azetidine moiety. This compound features a five-membered pyrrolidine ring fused to a four-membered azetidine ring, contributing to its potential biological activity. The presence of nitrogen atoms in both rings can influence its reactivity and interaction with biological systems, making it of interest in medicinal chemistry. The compound may exhibit properties such as being a potential ligand for various receptors or enzymes, which could be explored for therapeutic applications. Its molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, affecting its solubility and stability. Additionally, the stereochemistry of the compound can play a significant role in its pharmacological profile. As with many nitrogen-containing heterocycles, 3-(1-Azetidinyl)pyrrolidine may also be subject to various synthetic routes for its preparation, making it a valuable compound for research in drug development and organic synthesis.

Formula: C₇H₁₄N₂

InChI: InChI=1S/C7H14N2/c1-4-9(5-1)7-2-3-8-6-7/h7-8H,1-6H2

InChI key: InChIKey=FHIICFSXQPELBP-UHFFFAOYSA-N

SMILES: N1(CCC1)C2CCNC2

Synonyms:

• 3-(1-Azetidinyl)pyrrolidine
• Pyrrolidine, 3-(1-azetidinyl)-