CymitQuimica logo

CAS 101847-53-4

:

5-Chloro-4-(difluoromethoxy)-2-methylbenzenamine

Description:
5-Chloro-4-(difluoromethoxy)-2-methylbenzenamine, with the CAS number 101847-53-4, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom, a difluoromethoxy group, and an amino group. The presence of the chlorine atom and the difluoromethoxy group contributes to its unique chemical reactivity and potential applications in pharmaceuticals or agrochemicals. The amino group (-NH2) enhances its basicity and can participate in various chemical reactions, such as nucleophilic substitutions. This compound is likely to exhibit moderate to high polarity due to the electronegative fluorine and chlorine atoms, influencing its solubility in polar solvents. Additionally, the presence of multiple functional groups suggests that it may engage in hydrogen bonding, affecting its physical properties such as boiling and melting points. Overall, the compound's structure indicates potential utility in synthetic organic chemistry, particularly in the development of biologically active molecules.
Formula:C8H8ClF2NO
InChI:InChI=1S/C8H8ClF2NO/c1-4-2-7(13-8(10)11)5(9)3-6(4)12/h2-3,8H,12H2,1H3
InChI key:InChIKey=DYRCFEQJAONBGV-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=C(Cl)C=C(N)C(C)=C1
Synonyms:
  • 5-Chloro-4-(difluoromethoxy)-2-methylaniline
  • 5-Chloro-4-(difluoromethoxy)-2-methylbenzenamine
  • Benzenamine, 5-chloro-4-(difluoromethoxy)-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.