
CAS 101848-23-1
:1-Octadecen-1-ol
Description:
1-Octadecen-1-ol, also known as oleyl alcohol, is a long-chain fatty alcohol characterized by its unsaturated hydrocarbon structure, featuring an 18-carbon chain with a double bond located at the first carbon. This compound is typically a colorless to pale yellow liquid with a mild odor and is insoluble in water but soluble in organic solvents such as ethanol and ether. It has a relatively high boiling point and low volatility, which contributes to its stability under various conditions. 1-Octadecen-1-ol is commonly used in the production of surfactants, emulsifiers, and lubricants, as well as in the formulation of cosmetics and personal care products due to its moisturizing properties. Additionally, it serves as a precursor in the synthesis of various chemical compounds, including esters and amines. Its fatty alcohol nature imparts hydrophobic characteristics, making it useful in applications requiring water-repellent properties. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes.
Formula:C18H36O
InChI:InChI=1S/C18H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19/h17-19H,2-16H2,1H3
InChI key:InChIKey=JEGNXMUWVCVSSQ-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)CCCCCCC=CO
Synonyms:- 1-Octadecen-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
