CymitQuimica logo

CAS 10185-65-6

:

5-ethyl-3-(4-nitrophenyl)-1,2,4-oxadiazole

Description:
5-Ethyl-3-(4-nitrophenyl)-1,2,4-oxadiazole is an organic compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features an ethyl group at the 5-position and a para-nitrophenyl group at the 3-position, contributing to its unique chemical properties. It is typically a yellow crystalline solid, indicating the presence of the nitro group, which can influence its electronic properties and reactivity. The nitro group is known for its electron-withdrawing effects, which can enhance the compound's stability and alter its reactivity in various chemical reactions. 5-Ethyl-3-(4-nitrophenyl)-1,2,4-oxadiazole may exhibit interesting optical properties, making it a candidate for applications in materials science, particularly in organic electronics and photonic devices. Additionally, its structure suggests potential biological activity, warranting further investigation in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with nitro-substituted compounds.
Formula:C10H9N3O3
InChI:InChI=1S/C10H9N3O3/c1-2-9-11-10(12-16-9)7-3-5-8(6-4-7)13(14)15/h3-6H,2H2,1H3
InChI key:RLXJOMUXHZMTCH-UHFFFAOYSA-N
SMILES:CCC1=NC(=NO1)C2=CC=C(C=C2)[N+](=O)[O-]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.