CAS 10185-66-7
:5-Butyl-3-(3-nitrophenyl)-1,2,4-oxadiazole
Description:
5-Butyl-3-(3-nitrophenyl)-1,2,4-oxadiazole is a heterocyclic organic compound characterized by its oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring. This compound features a butyl group, which contributes to its hydrophobic characteristics, and a nitrophenyl substituent that enhances its electronic properties and potential reactivity. The presence of the nitro group can impart significant polarity and may influence the compound's solubility in various solvents. Typically, compounds like this are of interest in fields such as materials science, pharmaceuticals, and agrochemicals due to their potential applications in organic electronics, as fluorescent materials, or as intermediates in chemical synthesis. The stability and reactivity of 5-Butyl-3-(3-nitrophenyl)-1,2,4-oxadiazole can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, its unique structural features make it a subject of interest for further research and development in various chemical applications.
Formula:C12H13N3O3
InChI:InChI=1S/C12H13N3O3/c1-2-3-7-11-13-12(14-18-11)9-5-4-6-10(8-9)15(16)17/h4-6,8H,2-3,7H2,1H3
InChI key:InChIKey=SQJSMRSHJOWWNR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=CC1)C=2N=C(CCCC)ON2
Synonyms:- 1,2,4-Oxadiazole, 5-butyl-3-(3-nitrophenyl)-
- 5-Butyl-3-(3-nitrophenyl)-1,2,4-oxadiazole
- 1,2,4-Oxadiazole, 5-butyl-3-(m-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
