CAS 10185-68-9: 4-(5-METHYL-1,2,4-OXADIAZOL-3-YL)ANILINE
Description:4-(5-Methyl-1,2,4-oxadiazol-3-yl)aniline, with the CAS number 10185-68-9, is an organic compound characterized by its aromatic amine structure. It features a phenyl group attached to an aniline moiety, which is further substituted with a 5-methyl-1,2,4-oxadiazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the amine and oxadiazole functional groups. The oxadiazole ring contributes to its heterocyclic nature, which can influence its chemical behavior, including its potential as a ligand in coordination chemistry or as an intermediate in organic synthesis. Additionally, the methyl group on the oxadiazole can affect the compound's electronic properties and steric hindrance. Overall, this compound may find applications in pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and interactions with other chemical entities.
Formula:C9H9N3O
InChI:InChI=1/C9H9N3O/c1-6-11-9(12-13-6)7-2-4-8(10)5-3-7/h2-5H,10H2,1H3
- Synonyms:
- 4-(5-Methyl-1,2,4-oxadiazol-3-yl)aniline 97%
Benzenamine, 4-(5-methyl-1,2,4-oxadiazol-3-yl)-
Ref: IN-DA0005QL
| Undefined size | To inquire |
4-(5-Methyl-1,2,4-oxadiazol-3-yl)aniline
Ref: 54-OR9660
| 1g | 373.00 € | ||
| 250mg | 154.00 € |
4-(5-Methyl-1,2,4-oxadiazol-3-yl)aniline
Ref: 3D-KAA18568
| 5g | 1,538.00 € | ||
| 500mg | 443.00 € |
