CymitQuimica logo

CAS 10185-69-0

:

3-(5-methyl-1,2,4-oxadiazol-3-yl)aniline

Description:
3-(5-Methyl-1,2,4-oxadiazol-3-yl)aniline, with the CAS number 10185-69-0, is an organic compound characterized by its aromatic amine structure. It features a phenyl group attached to an aniline moiety, which is further substituted with a 5-methyl-1,2,4-oxadiazole ring. This oxadiazole ring contributes to the compound's unique chemical properties, including potential biological activity and stability under various conditions. The presence of the methyl group on the oxadiazole enhances its lipophilicity, which may influence its solubility and reactivity. The compound is typically solid at room temperature and may exhibit moderate to high melting points, depending on its purity and crystalline form. Its functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound's reactivity can be influenced by the electron-donating nature of the aniline group and the electron-withdrawing characteristics of the oxadiazole, making it a subject of interest in medicinal chemistry and materials science.
Formula:C9H9N3O
InChI:InChI=1/C9H9N3O/c1-6-11-9(12-13-6)7-3-2-4-8(10)5-7/h2-5H,10H2,1H3
InChI key:CTRGRIHPFAVSOF-UHFFFAOYSA-N
SMILES:Cc1nc(c2cccc(c2)N)no1
Synonyms:
  • Benzenamine, 3-(5-Methyl-1,2,4-Oxadiazol-3-Yl)-
Found 3 products.