CAS 101854-42-6
:Boc-D-Dab(Z)-OH . DCHA
Description:
Boc-D-Dab(Z)-OH.DCHA, with the CAS number 101854-42-6, is a chemical compound that features a protected amino acid structure. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions without interfering with the amine. The "Dab" refers to 2,4-diaminobutyric acid, indicating the presence of two amino groups in the molecule. The "(Z)" notation signifies that the compound has a specific geometric isomerism, typically referring to the configuration around a double bond, which can influence the compound's reactivity and properties. The "DCHA" part indicates the presence of a dihydrochloride salt, which can enhance the solubility of the compound in aqueous solutions. This compound is often utilized in peptide synthesis and medicinal chemistry due to its ability to facilitate the formation of peptide bonds while maintaining stability during various chemical reactions. Its characteristics make it valuable in the development of pharmaceuticals and biochemicals.
Formula:C29H47N3O6
InChI:InChI=1/C17H24N2O6.C12H23N/c1-17(2,3)25-16(23)19-13(14(20)21)9-10-18-15(22)24-11-12-7-5-4-6-8-12;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-8,13H,9-11H2,1-3H3,(H,18,22)(H,19,23)(H,20,21);11-13H,1-10H2/t13-;/m1./s1
SMILES:CC(C)(C)OC(=N[C@H](CCN=C(O)OCC1=CC=CC=C1)C(=O)O)O.C1CCC(CC1)NC1CCCCC1
Synonyms:- (2R)-4-benzyloxycarbonylamino-2-(tert-butoxycarbonylamino)butanoic acid
- N-cyclohexylcyclohexanamine
- Boc-D-Dab(Z)-Oh Dcha
- Boc-D-Dab(Z)-OH.DCHA
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(R)-4-Benzyloxycarbonylamino-2-(Boc-amino)butyric acid dicyclohexylammonium salt, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C29H47N3O6Purity:98%Molecular weight:533.71Butanoic Acid, 2-[[(1,1-Dimethylethoxy)Carbonyl]Amino]-4-[[(Phenylmethoxy)Carbonyl]Amino]-, (R)-, Compd. With N-Cyclohexylcyclohexanamine (1:1) (9CI)
CAS:Formula:C29H47N3O6Purity:95%Color and Shape:SolidMolecular weight:533.7000

