CAS 101855-91-8

5,5'-Bis(trifluoromethyl)-2,2'-dichlorobenzophenone

Description:

5,5'-Bis(trifluoromethyl)-2,2'-dichlorobenzophenone, with CAS number 101855-91-8, is an organic compound characterized by its complex molecular structure, which includes two benzophenone moieties substituted with trifluoromethyl and dichloro groups. This compound typically exhibits high thermal stability and is insoluble in water, making it suitable for various applications in organic synthesis and materials science. The presence of trifluoromethyl groups enhances its lipophilicity and can impart unique electronic properties, while the dichloro substitutions contribute to its reactivity and potential use as a photoinitiator in polymerization processes. Additionally, this compound may exhibit significant UV absorption characteristics, which can be advantageous in applications such as UV filters or stabilizers in plastics. Safety considerations should be taken into account due to the presence of halogenated groups, which may pose environmental and health risks. Overall, 5,5'-Bis(trifluoromethyl)-2,2'-dichlorobenzophenone is a notable compound in the field of organic chemistry with diverse potential applications.

Formula: C₁₅H₆Cl₂F₆O

InChI: InChI=1/C15H6Cl2F6O/c16-11-3-1-7(14(18,19)20)5-9(11)13(24)10-6-8(15(21,22)23)2-4-12(10)17/h1-6H

SMILES: c1cc(c(cc1C(F)(F)F)C(=O)c1cc(ccc1Cl)C(F)(F)F)Cl

Synonyms:

• Bis[2-Chloro-5-(Trifluoromethyl)Phenyl]Methanone

Methanone, bis[2-chloro-5-(trifluoromethyl)phenyl]-

CAS: 101855-91-8

Formula: C₁₅H₆Cl₂F₆O

Molecular weight: 387.104

Ref: IN-DA0005R6