CAS 101858-33-7
:N-methoxy-N-methyloctanamide
Description:
N-methoxy-N-methyloctanamide is an organic compound characterized by its amide functional group, which is derived from octanoic acid. It features a methoxy group (-OCH3) and a methyl group (-CH3) attached to the nitrogen atom, contributing to its unique properties. This compound is typically a colorless to pale yellow liquid with a moderate boiling point and low volatility, making it suitable for various applications in the chemical industry. Its structure suggests moderate polarity, which can influence its solubility in organic solvents and its interactions with other chemical species. N-methoxy-N-methyloctanamide may exhibit low toxicity, but safety data should be consulted for handling and exposure guidelines. Additionally, it may serve as a solvent, a reagent in organic synthesis, or a potential intermediate in the production of other chemical compounds. As with many amides, it may also participate in hydrogen bonding, affecting its physical properties and reactivity.
Formula:C10H21NO2
InChI:InChI=1/C10H21NO2/c1-4-5-6-7-8-9-10(12)11(2)13-3/h4-9H2,1-3H3
SMILES:CCCCCCCC(=O)N(C)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
