CAS 10186-64-8
:2,3,3,3-Tetrafluoro-2-methoxypropanoic acid
Description:
2,3,3,3-Tetrafluoro-2-methoxypropanoic acid is a fluorinated organic compound characterized by the presence of four fluorine atoms, a methoxy group, and a carboxylic acid functional group. Its molecular structure features a propanoic acid backbone, which contributes to its acidity and reactivity. The presence of fluorine atoms enhances its chemical stability and lipophilicity, making it useful in various applications, including as a potential intermediate in the synthesis of pharmaceuticals and agrochemicals. The methoxy group introduces additional polarity, influencing its solubility in organic solvents. This compound is typically colorless to pale yellow in appearance and may have a distinctive odor. Due to its fluorinated nature, it may exhibit unique properties such as increased resistance to thermal degradation and chemical reactivity compared to non-fluorinated analogs. Safety considerations are important when handling this substance, as fluorinated compounds can pose environmental and health risks. Overall, 2,3,3,3-Tetrafluoro-2-methoxypropanoic acid is a notable compound in the field of synthetic chemistry.
Formula:C4H4F4O3
InChI:InChI=1S/C4H4F4O3/c1-11-3(5,2(9)10)4(6,7)8/h1H3,(H,9,10)
InChI key:InChIKey=FVFNJRUHXHUZRC-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(O)=O)(OC)F
Synonyms:- 2,3,3,3-Tetrafluoro-2-methoxypropionic acid
- 2-Methoxy-2,3,3,3-tetrafluoropropionic acid
- Propanoic acid, 2,3,3,3-tetrafluoro-2-methoxy-
- Propionic acid, 2,3,3,3-tetrafluoro-2-methoxy-
- 2,3,3,3-Tetrafluoro-2-methoxypropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
