CAS 101861-36-3
:7,8-Dihydro-7-hydroxy-5-methyl-6(5H)-pteridinone
Description:
7,8-Dihydro-7-hydroxy-5-methyl-6(5H)-pteridinone, with the CAS number 101861-36-3, is a pteridine derivative characterized by its bicyclic structure, which includes a fused pyrimidine and pyrazine ring system. This compound features hydroxyl and methyl substituents, contributing to its unique chemical properties. It is typically recognized for its potential biological activity, particularly in the context of pharmacology and biochemistry, where it may interact with various biological targets. The presence of the hydroxyl group enhances its solubility in polar solvents, while the methyl group can influence its lipophilicity and overall reactivity. Additionally, the compound may exhibit antioxidant properties and could be involved in metabolic pathways related to folate and other pteridine derivatives. Its synthesis and characterization are of interest in medicinal chemistry, where modifications to the pteridine core can lead to compounds with enhanced therapeutic profiles. Overall, 7,8-Dihydro-7-hydroxy-5-methyl-6(5H)-pteridinone represents a significant structure in the study of bioactive molecules.
Formula:C7H8N4O2
InChI:InChI=1S/C7H8N4O2/c1-11-4-2-8-3-9-5(4)10-6(12)7(11)13/h2-3,6,12H,1H3,(H,8,9,10)
InChI key:InChIKey=ZBGAUULEZSORND-UHFFFAOYSA-N
SMILES:CN1C=2C(NC(O)C1=O)=NC=NC2
Synonyms:- 7,8-Dihydro-7-hydroxy-5-methyl-6(5H)-pteridinone
- 6(5H)-Pteridinone, 7,8-dihydro-7-hydroxy-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
