CymitQuimica logo

CAS 1018610-56-4

:

2-(2-Furanyl)-1-methylpiperazine

Description:
2-(2-Furanyl)-1-methylpiperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with a furan moiety and a methyl group. The presence of the furan ring contributes to its aromatic properties, while the piperazine structure provides basic nitrogen functionalities, making it potentially useful in various chemical reactions and applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in organic solvents, which enhances its utility in organic synthesis and medicinal chemistry. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs. Its molecular interactions can be influenced by the presence of the furan and piperazine groups, which may affect its pharmacokinetic and pharmacodynamic properties. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-11-5-4-10-7-8(11)9-3-2-6-12-9/h2-3,6,8,10H,4-5,7H2,1H3
InChI key:InChIKey=PTTQPOVLZFWTFX-UHFFFAOYSA-N
SMILES:CN1C(C2=CC=CO2)CNCC1
Synonyms:
  • Piperazine, 2-(2-furanyl)-1-methyl-
  • 2-(2-Furanyl)-1-methylpiperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.