
CAS 1018611-16-9
:4-(1-Methyl-2-piperazinyl)phenol
Description:
4-(1-Methyl-2-piperazinyl)phenol, identified by its CAS number 1018611-16-9, is a chemical compound characterized by the presence of a phenolic group substituted with a piperazine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the piperazine ring, which is known for its role in various pharmacological applications. The presence of the hydroxyl (-OH) group in the phenol structure contributes to its solubility in polar solvents and may influence its reactivity and interaction with other chemical species. Additionally, the methyl group on the piperazine enhances its lipophilicity, which can affect its permeability and bioavailability in biological systems. The compound may be of interest in medicinal chemistry for its potential therapeutic applications, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. As with many chemical substances, safety data and handling precautions should be considered, as the compound may exhibit toxicity or other hazardous properties.
Formula:C11H16N2O
InChI:InChI=1S/C11H16N2O/c1-13-7-6-12-8-11(13)9-2-4-10(14)5-3-9/h2-5,11-12,14H,6-8H2,1H3
InChI key:InChIKey=GOIBFXWZSVKEMC-UHFFFAOYSA-N
SMILES:CN1C(C2=CC=C(O)C=C2)CNCC1
Synonyms:- Phenol, 4-(1-methyl-2-piperazinyl)-
- 4-(1-Methyl-2-piperazinyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.