
CAS 1018635-75-0
:4-Methoxy-1H-indole-2-acetic acid
Description:
4-Methoxy-1H-indole-2-acetic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methoxy group (-OCH3) at the 4-position of the indole ring and an acetic acid functional group at the 2-position. It is typically classified as an indole derivative and may exhibit biological activity, potentially influencing various physiological processes. The presence of the methoxy group can enhance lipophilicity, affecting its solubility and permeability in biological systems. The acetic acid moiety may contribute to its acidity and potential interactions with biological targets. This compound is of interest in medicinal chemistry and pharmacology, as indole derivatives are known for their diverse biological activities, including anti-inflammatory and anticancer properties. However, specific applications and effects would depend on further research and characterization. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c1-15-10-4-2-3-9-8(10)5-7(12-9)6-11(13)14/h2-5,12H,6H2,1H3,(H,13,14)
InChI key:InChIKey=WKEUFZWVAOLOEK-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(NC(CC(O)=O)=C2)=CC=C1
Synonyms:- 1H-Indole-2-acetic acid, 4-methoxy-
- 4-Methoxy-1H-indole-2-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.