CAS 1018678-38-0

4-Amino-2-chloro-3-pyridinecarboxylic acid

Description:

4-Amino-2-chloro-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the pyridine ring, along with a chlorine atom at the 2-position. The presence of these functional groups contributes to its potential as a building block in pharmaceutical synthesis and agrochemical applications. The amino group can participate in various chemical reactions, such as nucleophilic substitutions, while the carboxylic acid group can engage in acid-base reactions. The chlorine atom may influence the compound's reactivity and solubility. Additionally, the compound's structure suggests it may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility and stability in different solvents can vary, which is important for its practical applications. Overall, 4-Amino-2-chloro-3-pyridinecarboxylic acid is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₆H₅ClN₂O₂

InChI: InChI=1S/C6H5ClN2O2/c7-5-4(6(10)11)3(8)1-2-9-5/h1-2H,(H2,8,9)(H,10,11)

InChI key: InChIKey=KSWQBRYDZAEYQP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(N)=CC=NC1Cl

Synonyms:

• 3-Pyridinecarboxylic acid, 4-amino-2-chloro-
• 2-Chloro-4-aminonicotinic acid
• 4-Amino-2-chloro-3-pyridinecarboxylic acid

3-Pyridinecarboxylic acid, 4-amino-2-chloro-

CAS: 1018678-38-0

Formula: C₆H₅ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 172.5691

Ref: IN-DA0005S5

4-Amino-2-chloropyridine-3-carboxylic acid

CAS: 1018678-38-0

4-Amino-2-chloropyridine-3-carboxylic acid

Purity: 98%

Molecular weight: 172.57g/mol

Ref: 54-OR76695

4-AMINO-2-CHLORONICOTINIC ACID

CAS: 1018678-38-0

Formula: C₆H₅ClN₂O₂

Purity: 98%

Molecular weight: 172.57

Ref: 10-F389439