CAS 101870-29-5

Phenol, 2-amino-5-methoxy-4-methyl-

Description:

Phenol, 2-amino-5-methoxy-4-methyl-, also known by its CAS number 101870-29-5, is an organic compound that features a phenolic structure with an amino group and methoxy and methyl substituents. This compound is characterized by its aromatic ring, which contributes to its chemical stability and reactivity. The presence of the amino group (-NH2) enhances its potential for hydrogen bonding, making it more soluble in polar solvents. The methoxy group (-OCH3) and the methyl group (-CH3) are electron-donating substituents that can influence the compound's reactivity and interaction with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its physical properties, such as melting point and boiling point, can vary based on purity and environmental conditions. Overall, the unique combination of functional groups in this compound suggests potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₈H₁₁NO₂

InChI: InChI=1S/C8H11NO2/c1-5-3-6(9)7(10)4-8(5)11-2/h3-4,10H,9H2,1-2H3

InChI key: InChIKey=IFNNXEGYCIBJCW-UHFFFAOYSA-N

SMILES: O(C)C1=C(C)C=C(N)C(O)=C1

Synonyms:

• p-Cresol, 2-amino-5-methoxy-
• 2-Amino-5-methoxy-4-methylphenol
• Phenol, 2-amino-5-methoxy-4-methyl-