CAS 101870-58-0
:2,5,7-trichloroquinolin-8-ol
Description:
2,5,7-Trichloroquinolin-8-ol is a synthetic organic compound characterized by its quinoline structure, which features a fused bicyclic system containing nitrogen. This compound is notable for the presence of three chlorine atoms at the 2, 5, and 7 positions, along with a hydroxyl group (-OH) at the 8 position. The chlorination enhances its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. It exhibits properties typical of halogenated compounds, such as increased lipophilicity and potential bioactivity. The hydroxyl group contributes to its solubility in polar solvents and may influence its interaction with biological targets. Additionally, the compound's structure suggests potential for use in medicinal chemistry, particularly in the development of antimicrobial or antiprotozoal agents. Safety and handling considerations are essential due to the presence of chlorine, which can pose environmental and health risks. Overall, 2,5,7-trichloroquinolin-8-ol represents a compound of interest for further research and application in various chemical and biological contexts.
Formula:C9H4Cl3NO
InChI:InChI=1/C9H4Cl3NO/c10-5-3-6(11)9(14)8-4(5)1-2-7(12)13-8/h1-3,14H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
