CAS 1018812-91-3: 8-Chloro-1H-1,7-naphthyridin-4-one

Description:8-Chloro-1H-1,7-naphthyridin-4-one is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. The presence of a chlorine substituent at the 8-position and a carbonyl group at the 4-position contributes to its chemical reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many naphthyridine derivatives. It may participate in various chemical reactions, including nucleophilic substitutions and cyclization, due to the electrophilic nature of the carbonyl group. Additionally, compounds of this class have been studied for their pharmacological properties, including antimicrobial and anticancer activities. The specific characteristics, such as melting point, boiling point, and spectral data (NMR, IR, etc.), would provide further insights into its physical and chemical behavior, but these details are typically found in specialized chemical databases or literature.

Formula:C₈H₅N₂OCl

InChI:InChI=1S/C8H5ClN2O/c9-8-7-5(1-3-11-8)6(12)2-4-10-7/h1-4H,(H,10,12)

Synonyms:
8-Chloro-1,7-naphthyridin-4(1H)-one
8-Chloro-1,7-Naphthyridin-4-Ol
8-Chloro-1H-[1,7]naphthyridin-4-one

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1,7-Naphthyridin-4(1H)-one, 8-chloro- REF: IN-DA0005TPCAS: 1018812-91-3	97%	To inquire	Tue 04 Mar 25
8-Chloro-1,7-naphthyridin-4(1H)-one REF: 54-OR73134CAS: 1018812-91-3	0.95	567.00 €~6,000.00 €	Mon 03 Mar 25
8-Chloro-1H-1,7-naphthyridin-4-one REF: 10-F049176CAS: 1018812-91-3	95.0%	To inquire	Wed 12 Mar 25
8-Chloro-1H-1,7-naphthyridin-4-one REF: 3D-TQB81291CAS: 1018812-91-3	Min. 95%	- - -	Discontinued product