CymitQuimica logo

CAS 10189-46-5

:

Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one

Description:
Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one, with the CAS number 10189-46-5, is a heterocyclic compound characterized by a fused ring system that includes a pyridine and a benzoxazepine structure. This compound typically exhibits a pale yellow to brownish color and is known for its potential biological activity, particularly in medicinal chemistry. Its molecular structure features a nitrogen-containing heterocycle, which can influence its reactivity and interaction with biological targets. The presence of the benzoxazepine moiety suggests potential applications in pharmaceuticals, particularly as a scaffold for drug development. Additionally, the compound may exhibit properties such as fluorescence or photostability, depending on its specific substituents and environment. Its solubility and stability can vary based on the solvent and conditions, making it important for researchers to consider these factors in experimental applications. Overall, Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one represents a class of compounds with intriguing chemical properties and potential therapeutic uses.
Formula:C12H8N2O2
InChI:InChI=1S/C12H8N2O2/c15-11-8-4-3-7-13-12(8)16-10-6-2-1-5-9(10)14-11/h1-7H,(H,14,15)
InChI key:InChIKey=SMKXEJRITQTCCL-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC=3C(N1)=CC=CC3)=NC=CC2
Synonyms:
  • benzo[b]pyrido[3,2-f][1,4]oxazepin-5(6H)-one
  • 10H-5-Oxa-4,10-diaza-dibenzo[a,d]cyclohepten-11-one
  • Pyrido[2,3-b][1,5]benzoxazepin-5(6H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.