CymitQuimica logo

CAS 101896-21-3

:

4,6-Dioxa-3,7-diaza-5-phosphanonane-1,9-diol, 3,7-bis(2-hydroxyethyl)-5-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)oxy]-, 5-oxide

Description:
4,6-Dioxa-3,7-diaza-5-phosphanonane-1,9-diol, commonly referred to by its CAS number 101896-21-3, is a complex chemical compound characterized by its unique structural features, including multiple functional groups such as hydroxyl (-OH), ether, and phosphonate moieties. This compound contains a phosphorous atom integrated into a cyclic structure, which contributes to its potential applications in various fields, including materials science and biochemistry. The presence of fluorinated alkyl chains suggests that it may exhibit hydrophobic properties, enhancing its utility in formulations requiring water repellency or surface modification. Additionally, the presence of nitrogen and oxygen atoms indicates potential for hydrogen bonding and solubility in polar solvents. Its intricate structure may also impart specific biological activities, making it of interest in pharmaceutical research. However, detailed studies on its reactivity, stability, and environmental impact would be essential for understanding its practical applications and safety profile.
Formula:C19H24F19N2O8P
InChI:InChI=1S/C19H24F19N2O8P/c20-11(21,1-10-46-49(45,47-39(2-6-41)3-7-42)48-40(4-8-43)5-9-44)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)18(34,35)19(36,37)38/h41-44H,1-10H2
InChI key:InChIKey=UQHBROJZQLWASU-UHFFFAOYSA-N
SMILES:P(ON(CCO)CCO)(ON(CCO)CCO)(OCCC(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)=O
Synonyms:
  • 4,6-Dioxa-3,7-diaza-5-phosphanonane-1,9-diol, 3,7-bis(2-hydroxyethyl)-5-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)oxy]-, 5-oxide
  • Bis(Bis(2-Hydroxyethyl)Amino) 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-Nonadecafluoroundecyl Phosphate
  • 3,7-Bis(2-hydroxyethyl)-5-[(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)oxy]-4,6-dioxa-3,7-diaza-5-phosphanonane-1,9-diol 5-oxide
  • 3,7-Bis(2-hydroxyethyl)-5-((3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-nonadecafluoroundecyl)oxy)-4,6-dioxa-3,7-diaza-5-phosphanonane-1,9-diol 5-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.