CAS 1018978-84-1

(4S)-5-Fluoro-3,4-dihydro-2H-1-benzopyran-4-amine

Description:

(4S)-5-Fluoro-3,4-dihydro-2H-1-benzopyran-4-amine, with the CAS number 1018978-84-1, is a chemical compound characterized by its unique bicyclic structure, which includes a benzopyran moiety. This compound features a fluorine atom at the 5-position and an amine group at the 4-position, contributing to its potential biological activity. The stereochemistry indicated by the (4S) designation suggests that the compound has a specific three-dimensional arrangement, which can significantly influence its interactions with biological targets. The presence of the dihydro group indicates that the compound is partially saturated, which may affect its reactivity and stability. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including anti-inflammatory or anticancer activities. The solubility, melting point, and other physical properties would depend on the specific conditions and the presence of functional groups, making it essential to conduct further studies for detailed characterization.

Formula: C₉H₁₀FNO

InChI: InChI=1S/C9H10FNO/c10-6-2-1-3-8-9(6)7(11)4-5-12-8/h1-3,7H,4-5,11H2/t7-/m0/s1

InChI key: InChIKey=MUOIMTYOOKUVEP-ZETCQYMHSA-N

SMILES: N[C@@H]1C=2C(=CC=CC2F)OCC1

Synonyms:

• 2H-1-Benzopyran-4-amine, 5-fluoro-3,4-dihydro-, (4S)-
• (4S)-5-Fluoro-3,4-dihydro-2H-1-benzopyran-4-amine
• (4s)-5-Fluorochromane-4-ylamine