CAS 1018978-88-5

(4S)-3,4-Dihydro-6-methyl-2H-1-benzopyran-4-amine

Description:

(4S)-3,4-Dihydro-6-methyl-2H-1-benzopyran-4-amine is a chemical compound characterized by its unique bicyclic structure, which includes a benzopyran moiety. This compound features a dihydro form, indicating the presence of a saturated ring system, and a methyl group at the 6-position, contributing to its hydrophobic properties. The amine functional group at the 4-position suggests potential basicity and reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. The stereochemistry denoted by (4S) indicates that the compound has a specific three-dimensional arrangement, which can influence its biological activity and interactions with other molecules. This compound may exhibit pharmacological properties, potentially making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, (4S)-3,4-Dihydro-6-methyl-2H-1-benzopyran-4-amine represents a complex organic molecule with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₀H₁₃NO

InChI: InChI=1S/C10H13NO/c1-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-3,6,9H,4-5,11H2,1H3/t9-/m0/s1

InChI key: InChIKey=LXNRUKZCRQFUCU-VIFPVBQESA-N

SMILES: N[C@@H]1C=2C(=CC=C(C)C2)OCC1

Synonyms:

• 2H-1-Benzopyran-4-amine, 3,4-dihydro-6-methyl-, (4S)-
• (4S)-6-Methyl-3,4-dihydro-2H-chromen-4-amine
• (S)-6-Methylchroman-4-amine
• (4S)-3,4-Dihydro-6-methyl-2H-1-benzopyran-4-amine

(S)-6-Methylchroman-4-amine

CAS: 1018978-88-5

Formula: C₁₀H₁₃NO

Molecular weight: 163.2163

Ref: IN-DA0005UY