CAS 1019-03-0

2-propylquinoline-4-carboxylic acid

Description:

2-Propylquinoline-4-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a propyl group at the second position and a carboxylic acid functional group at the fourth position of the quinoline ring. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while its solubility in water is generally limited due to the hydrophobic nature of the quinoline structure. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 2-propylquinoline-4-carboxylic acid may exhibit biological activity, making it of interest in pharmaceutical research. Its unique structure contributes to its potential applications in organic synthesis and as a building block in the development of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1/C13H13NO2/c1-2-5-9-8-11(13(15)16)10-6-3-4-7-12(10)14-9/h3-4,6-8H,2,5H2,1H3,(H,15,16)

SMILES: CCCc1cc(c2ccccc2n1)C(=O)O

Synonyms:

• 4-Quinolinecarboxylic Acid, 2-Propyl-

2-Propylquinoline-4-carboxylic acid

CAS: 1019-03-0

Formula: C₁₃H₁₃NO₂

Purity: 97%

Molecular weight: 215.2478

Ref: IN-DA0005VH

2-Propylquinoline-4-carboxylic acid

CAS: 1019-03-0

2-Propylquinoline-4-carboxylic acid

Purity: 97%

Molecular weight: 215.25g/mol

Ref: 54-OR76957

2-propylquinoline-4-carboxylic acid

CAS: 1019-03-0

Formula: C₁₃H₁₃NO₂

Purity: 97%

Molecular weight: 215.252

Ref: 10-F369015