CAS 1019-52-9: 4-Hydroxy-3,5-dinitrobenzoic acid

Description:4-Hydroxy-3,5-dinitrobenzoic acid, with the CAS number 1019-52-9, is an organic compound characterized by its aromatic structure featuring a benzoic acid core substituted with two nitro groups and a hydroxyl group. This compound typically appears as a yellow crystalline solid and is known for its strong acidic properties due to the carboxylic acid functional group. The presence of nitro groups contributes to its electron-withdrawing characteristics, which can influence its reactivity and stability. It is often used in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. Additionally, the hydroxyl group can participate in hydrogen bonding, affecting its solubility in various solvents. The compound is also of interest in studies related to environmental chemistry and toxicology, as nitro-substituted compounds can exhibit significant biological activity. Proper handling and safety precautions are essential due to its potential toxicity and environmental impact.

Formula:C₇H₄N₂O₇

InChI:InChI=1S/C7H4N2O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H,(H,11,12)

InChI key:InChIKey=GBSWIDSKAJFWMF-UHFFFAOYSA-N

SMILES:O=C(O)C=1C=C(C(O)=C(C1)N(=O)=O)N(=O)=O

Synonyms:
3,5-Dinitro-4-Oxidobenzoate
4-Hydroxy-3,5-dinitrobenzoic acid
Benzoic acid, 4-hydroxy-3,5-dinitro-
3,5-Dinitro-4-hydroxybenzoic acid

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4-Hydroxy-3,5-dinitrobenzoic acid, 98+% REF: 02-B22474CAS: 1019-52-9	98+%	To inquire	Mon 24 Feb 25
Benzoic acid, 4-hydroxy-3,5-dinitro- REF: IN-DA0005VACAS: 1019-52-9	96%	96.00 €~519.00 €	Tue 04 Mar 25
4-Hydroxy-3,5-dinitrobenzoic acid REF: 10-F723865CAS: 1019-52-9	98%	94.00 €~297.00 €	Wed 05 Mar 25
3,5-Dinitro-4-hydroxybenzoic Acid REF: TR-D493015CAS: 1019-52-9	- - -	99.00 €~339.00 €	Wed 12 Mar 25
3,5-Dinitro-4-hydroxybenzoic acid REF: 3D-FD70464CAS: 1019-52-9	Min. 95%	143.00 €~1,339.00 €	Thu 13 Mar 25