
CAS 1019-80-3
:4-Phenyl-2-pyridinecarboximidic acid hydrazide
Description:
4-Phenyl-2-pyridinecarboximidic acid hydrazide, with the CAS number 1019-80-3, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a hydrazide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. It is often utilized in organic synthesis and may serve as an intermediate in the preparation of various pharmaceuticals or agrochemicals. The presence of the phenyl group enhances its lipophilicity, while the carboximidic acid moiety can participate in hydrogen bonding and other interactions, influencing its solubility and stability. Additionally, the compound may exhibit specific optical properties due to its conjugated system, making it of interest in materials science and medicinal chemistry. As with many hydrazides, it may also display biological activity, warranting further investigation into its pharmacological properties. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C12H12N4
InChI:InChI=1S/C12H12N4/c13-12(16-14)11-8-10(6-7-15-11)9-4-2-1-3-5-9/h1-8H,14H2,(H2,13,16)
InChI key:InChIKey=NDKWVYKEXQBMOW-UHFFFAOYSA-N
SMILES:C(NN)(=N)C1=CC(=CC=N1)C2=CC=CC=C2
Synonyms:- Picolinimidic acid, 4-phenyl-, hydrazide
- 2-Pyridinecarboximidic acid, 4-phenyl-, hydrazide
- 4-Phenyl-2-pyridylhydrazidine
- 4-Phenyl-2-pyridinecarboximidic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
