CAS 10190-93-9: Testosterone (carboxymethyl)oxime
Description:Testosterone (carboxymethyl)oxime, with the CAS number 10190-93-9, is a derivative of testosterone, a steroid hormone primarily involved in the development of male reproductive tissues and secondary sexual characteristics. This compound features a carboxymethyl oxime functional group, which modifies the steroid structure, potentially influencing its biological activity and solubility. The presence of the oxime group may enhance its reactivity and interaction with biological targets. Testosterone derivatives are often studied for their pharmacological properties, including anabolic effects and potential therapeutic applications in hormone replacement therapy or muscle-wasting conditions. The compound is typically characterized by its molecular formula, which reflects the modifications made to the testosterone backbone, and its physical properties, such as melting point, solubility, and stability under various conditions. As with many steroid derivatives, the synthesis and characterization of testosterone (carboxymethyl)oxime are of interest in medicinal chemistry and pharmacology, particularly in understanding its mechanism of action and potential side effects.
Formula:C21H31NO4
InChI:InChI=1S/C21H31NO4/c1-20-9-7-14(22-26-12-19(24)25)11-13(20)3-4-15-16-5-6-18(23)21(16,2)10-8-17(15)20/h11,15-18,23H,3-10,12H2,1-2H3,(H,24,25)/t15-,16-,17-,18-,20-,21-/m0/s1
InChI key:InChIKey=VDYLVWGBLQNNAW-ZKHIMWLXSA-N
SMILES:O=C(O)CON=C1C=C2CCC3C(CCC4(C)C(O)CCC34)C2(C)CC1
- Synonyms:
- Testosterone, O-(carboxymethyl)oxime
- Acetic acid, [[[(17β)-17-hydroxyandrost-4-en-3-ylidene]amino]oxy]-
- Androstane, acetic acid deriv.
- Acetic acid, [[(17β-hydroxyandrost-4-en-3-ylidene)amino]oxy]-
- Acetic acid, 2-[[[(17β)-17-hydroxyandrost-4-en-3-ylidene]amino]oxy]-

Acetic acid, 2-[[[(17β)-17-hydroxyandrost-4-en-3-ylidene]amino]oxy]-
Ref: IN-DA0005VU
Undefined size | To inquire |

Testosterone 3-(O-carboxymethyl)oxime (Mixture of Conformers)
Controlled ProductRef: TR-T223455
100mg | 1,151.00 € |

Testosterone 3-(O-carboxymethyl)oxime
Controlled ProductRef: 3D-FT159108
25mg | 932.00 € | ||
50mg | 1,377.00 € | ||
100mg | 2,504.00 € | ||
250mg | 5,634.00 € |