CAS 101901-06-8
:ethyl (8-ethyl-6-hydroxy-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate
Description:
Ethyl (8-ethyl-6-hydroxy-1,3,4,9-tetrahydropyrano[3,4-b]indol-1-yl)acetate, with the CAS number 101901-06-8, is a chemical compound that belongs to a class of indole derivatives. It features a complex structure characterized by a tetrahydropyrano ring fused to an indole moiety, which contributes to its potential biological activity. The presence of an ethyl group and a hydroxy functional group suggests that it may exhibit solubility in organic solvents and could participate in hydrogen bonding. This compound may be of interest in medicinal chemistry due to its structural features, which could influence its pharmacological properties. Additionally, the acetate functional group indicates that it may undergo hydrolysis, leading to the release of acetic acid and the corresponding alcohol. While specific biological activities and applications may vary, compounds of this nature are often investigated for their potential roles in drug development, particularly in the fields of neuropharmacology and anti-cancer research. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C17H21NO4
InChI:InChI=1/C17H21NO4/c1-3-10-7-11(19)8-13-12-5-6-22-14(9-15(20)21-4-2)17(12)18-16(10)13/h7-8,14,18-19H,3-6,9H2,1-2H3
SMILES:CCc1cc(cc2c3CCOC(CC(=O)OCC)c3[nH]c12)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
6-Hydroxy Etodolac
CAS:Controlled ProductApplications 6-Hydroxy Etodolac is an Etodolac (E933100) metabolite.
References Humber, L., et al.: J. Med. Chem., 32, 2582 (1989), Koupai-Abyazani, M., et al.: J. Anal. Toxicol., 23, 200 (1999),Formula:C17H21NO4Color and Shape:NeatMolecular weight:303.356-hydroxy Etodolac
CAS:6-Hydroxy Etodolac, a metabolite of the non-steroidal anti-inflammatory drug (NSAID) and COX inhibitor etodolac, causes false positives in diazo diagnostic tests for urinary bilirubin.Formula:C17H21NO4Color and Shape:SolidMolecular weight:303.35




