CAS 1019027-73-6

3-Chloro-8-phenylimidazo[1,2-a]pyridine

Description:

3-Chloro-8-phenylimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazo[1,2-a]pyridine core, which features a chlorine atom at the 3-position and a phenyl group at the 8-position. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry, where it may exhibit properties relevant to drug development. The presence of the chlorine substituent can influence its reactivity and solubility, while the phenyl group may enhance its lipophilicity, potentially affecting its pharmacokinetics. The imidazo[1,2-a]pyridine framework is known for its role in various biological systems and can serve as a scaffold for the design of novel therapeutic agents. Additionally, the compound's structural features may contribute to its interactions with biological targets, making it of interest in research related to cancer, inflammation, and other diseases. As with many heterocycles, its synthesis and characterization are crucial for understanding its properties and potential applications in pharmaceuticals.

Formula: C₁₃H₉ClN₂

InChI: InChI=1S/C13H9ClN2/c14-12-9-15-13-11(7-4-8-16(12)13)10-5-2-1-3-6-10/h1-9H

InChI key: InChIKey=OYBSKRUFWWIXEX-UHFFFAOYSA-N

SMILES: ClC=1N2C(C(=CC=C2)C3=CC=CC=C3)=NC1

Synonyms:

• 3-Chloro-8-phenylimidazo[1,2-a]pyridine
• Imidazo[1,2-a]pyridine, 3-chloro-8-phenyl-