CAS 101904-51-2

9,10-Dihydro-9-oxo-2-(phenylamino)-3-acridinecarboxylic acid

Description:

9,10-Dihydro-9-oxo-2-(phenylamino)-3-acridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes an acridine core, a phenylamino group, and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, while the phenylamino moiety may enhance its solubility and reactivity. The acridine framework is known for its role in various biological activities, including antitumor and antimicrobial properties. Additionally, the compound may exhibit fluorescence due to its conjugated system, making it of interest in photochemical applications. Its molecular interactions can be influenced by factors such as pH and solvent polarity, which are crucial for its behavior in biological systems or synthetic reactions. Overall, 9,10-Dihydro-9-oxo-2-(phenylamino)-3-acridinecarboxylic acid represents a unique structure with potential applications in medicinal chemistry and materials science.

Formula: C₂₀H₁₄N₂O₃

InChI: InChI=1S/C20H14N2O3/c23-19-13-8-4-5-9-16(13)22-17-11-15(20(24)25)18(10-14(17)19)21-12-6-2-1-3-7-12/h1-11,21H,(H,22,23)(H,24,25)

InChI key: InChIKey=HKQTUROKKAXNFP-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC=3C1=CC=CC3)=CC(C(O)=O)=C(NC4=CC=CC=C4)C2

Synonyms:

• 9,10-Dihydro-9-oxo-2-(phenylamino)-3-acridinecarboxylic acid
• 2-Anilino-3-carboxyacridone
• 2-(Phenyl)amino-3-carboxy-9(10H)acridinone
• 3-Carboxy-2-N-phenylamino-9-acridanone
• 3-Acridinecarboxylic acid, 9,10-dihydro-9-oxo-2-(phenylamino)-

3-Acridinecarboxylic acid, 9,10-dihydro-9-oxo-2-(phenylamino)-

CAS: 101904-51-2

Formula: C₂₀H₁₄N₂O₃

Molecular weight: 330.3368

Ref: IN-DA0005WT