CAS 1019056-31-5

4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid

Description:

4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid is a heterocyclic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 4-position and a carboxylic acid functional group at the 7-position enhances its reactivity and solubility in polar solvents. This compound is typically used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. Its structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. The compound's molecular framework may exhibit interesting interactions with biological targets, which can be explored for therapeutic applications. Additionally, its stability under standard laboratory conditions and its ability to form hydrogen bonds due to the carboxylic acid group can influence its behavior in biological systems. Overall, 4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid is a significant compound in the field of organic and medicinal chemistry.

Formula: C₇H₄ClN₃O₂

InChI: InChI=1/C7H4ClN3O2/c8-6-5-4(10-2-11-6)3(1-9-5)7(12)13/h1-2,9H,(H,12,13)

SMILES: c1c(c2c(c(Cl)ncn2)[nH]1)C(=O)O

Synonyms:

• 5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid, 4-chloro-

4-CHLORO-5H-PYRROLO[3,2-D]PYRIMIDINE-7-CARBOXYLIC ACID

CAS: 1019056-31-5

Formula: C₇H₄ClN₃O₂

Color and Shape: Solid

Molecular weight: 197.5786

Ref: IN-DA0005W6

4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid

CAS: 1019056-31-5

4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid

Molecular weight: 197.57856g/mol

Ref: 54-OR1021683

4-Chloro-5H-pyrrolo[3,2-d]pyrimidine-7-carboxylic acid

CAS: 1019056-31-5

Versatile small molecule scaffold

Formula: C₇H₄ClN₃O₂

Purity: Min. 95%

Molecular weight: 197.58 g/mol

Ref: 3D-UQB05631