CymitQuimica logo

CAS 101908-22-9

:

(5S,6S)-6-(4-hydroxyphenyl)-6-methyl-5-[9-(4,4,5,5,5-pentafluoropentyl sulfinyl)nonyl]tetralin-2-ol

Description:
The chemical substance with the name "(5S,6S)-6-(4-hydroxyphenyl)-6-methyl-5-[9-(4,4,5,5,5-pentafluoropentyl sulfinyl)nonyl]tetralin-2-ol" and CAS number "101908-22-9" is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a tetralin core structure, which is a bicyclic compound, and includes a hydroxyl group (-OH) and a methyl group (-CH3) at the 6-position, contributing to its potential biological activity. The presence of a 4-hydroxyphenyl group enhances its reactivity and solubility in organic solvents. Additionally, the compound contains a long alkyl chain with a sulfinyl group, which may influence its lipophilicity and interaction with biological membranes. The pentafluoropentyl sulfinyl moiety suggests that the compound may exhibit unique electronic properties due to the presence of fluorine atoms, which can affect its stability and reactivity. Overall, this compound may have applications in medicinal chemistry or materials science, although specific biological or chemical properties would require further investigation.
Formula:C31H41F5O3S
InChI:InChI=1/C31H41F5O3S/c1-29(24-11-13-25(37)14-12-24)19-17-23-22-26(38)15-16-27(23)28(29)10-7-5-3-2-4-6-8-20-40(39)21-9-18-30(32,33)31(34,35)36/h11-16,22,28,37-38H,2-10,17-21H2,1H3/t28-,29-,40?/m1/s1
SMILES:C[C@@]1(CCc2cc(ccc2[C@H]1CCCCCCCCCS(=O)CCCC(C(F)(F)F)(F)F)O)c1ccc(cc1)O
Synonyms:
  • Zm 189154
  • (5S,6S)-6-(4-hydroxyphenyl)-6-methyl-5-{9-[(4,4,5,5,5-pentafluoropentyl)sulfinyl]nonyl}-5,6,7,8-tetrahydronaphthalen-2-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.