CAS 101909-43-7: Methyl 4-bromo-1H-indole-3-carboxylate

Description:Methyl 4-bromo-1H-indole-3-carboxylate is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 4-position of the indole ring introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The carboxylate functional group, esterified with a methyl group, contributes to its solubility and potential for further chemical transformations. This compound is often utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Additionally, the bromine substituent can enhance the compound's electrophilicity, making it a useful intermediate in various reactions, including nucleophilic substitutions. Overall, Methyl 4-bromo-1H-indole-3-carboxylate exhibits properties typical of halogenated indoles, including potential biological activity and utility in synthetic applications.

Formula:C₁₀H₈BrNO₂

InChI:InChI=1S/C10H8BrNO2/c1-14-10(13)6-5-12-8-4-2-3-7(11)9(6)8/h2-5,12H,1H3

InChI key:InChIKey=MPAHRSJGIHOVOK-UHFFFAOYSA-N

SMILES:O=C(OC)C1=CNC=2C=CC=C(Br)C21

Synonyms:
1H-Indole-3-carboxylic acid, 4-bromo-, methyl ester
Methyl 4-bromo-1H-indole-3-carboxylate
Methyl 4-bromo-3-indolecarboxylate

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	1H-Indole-3-carboxylic acid, 4-bromo-, methyl ester REF: IN-DA0005X2CAS: 101909-43-7	- - -	To inquire	Tue 06 May 25
	Methyl 4-Bromoindole-3-carboxylate REF: 3D-BEA90943CAS: 101909-43-7	Min. 95%	- - -	Discontinued product