CAS 10191-90-9
:3-CHLORO-5-METHYLTHIO-1,2,4-THIADIAZOLE
Description:
3-Chloro-5-methylthio-1,2,4-thiadiazole is a heterocyclic compound characterized by a five-membered ring containing two nitrogen atoms and three carbon atoms, along with sulfur. The presence of a chlorine atom at the 3-position and a methylthio group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is known for its potential applications in agricultural chemistry, particularly as a fungicide or herbicide. Its structure allows for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it versatile in synthetic organic chemistry. The compound's reactivity can be influenced by the electronegative chlorine and sulfur atoms, which can participate in various interactions. Additionally, 3-chloro-5-methylthio-1,2,4-thiadiazole may exhibit biological activity, although specific biological properties would require further investigation. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance.
Formula:C3H3ClN2S2
InChI:InChI=1/C3H3ClN2S2/c1-7-3-5-2(4)6-8-3/h1H3
SMILES:CSc1nc(Cl)ns1
Synonyms:- 1,2,4-Thiadiazole, 3-chloro-5-(methylthio)-
- 3-Chloro-5-(methylsulfanyl)-1,2,4-thiadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Chloro-5-methylthio-1,2,4-thiadiazole
CAS:Formula:C3H3ClN2S2Color and Shape:SolidMolecular weight:166.64

