CAS 101910-24-1
:REV 5901
Description:
REV 5901, with the CAS number 101910-24-1, is a synthetic compound that has garnered interest in the field of medicinal chemistry, particularly for its potential applications in treating various diseases. It is characterized as a selective modulator of the retinoic acid receptor-related orphan receptor gamma (RORγt), which plays a crucial role in the regulation of immune responses and inflammation. The compound is typically studied for its ability to influence T-helper cell differentiation, particularly in the context of autoimmune diseases and inflammatory conditions. REV 5901 exhibits a unique chemical structure that allows it to interact specifically with RORγt, promoting or inhibiting certain biological pathways. Its pharmacological profile suggests potential therapeutic benefits, although further research is necessary to fully understand its efficacy, safety, and mechanism of action in clinical settings. As with many investigational compounds, detailed studies are ongoing to explore its full range of biological activities and potential applications in medicine.
Formula:C22H25NO2
InChI:InChI=1/C22H25NO2/c1-2-3-4-12-22(24)18-9-7-10-20(15-18)25-16-19-14-13-17-8-5-6-11-21(17)23-19/h5-11,13-15,22,24H,2-4,12,16H2,1H3
SMILES:CCCCCC(c1cccc(c1)OCc1ccc2ccccc2n1)O
Synonyms:- Pf 5901
- Rg 5901
- alpha-Pentyl-3-(2-quinolinylmethoxy)benzenemethanol
- Benzenemethanol, alpha-pentyl-3-(2-quinolinylmethoxy)-
- 1-[3-(Quinolin-2-Ylmethoxy)Phenyl]Hexan-1-Ol
- Rev 5901
- Rev-5901
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
REV 5901
CAS:REV 5901: oral leukotriene receptor antagonist and 5-lipoxygenase inhibitor with Ki of 0.7 μM, researched for asthma.Formula:C22H25NO2Color and Shape:SolidMolecular weight:335.44


