CAS 1019107-99-3
:4-(4-Methoxyphenyl)-2-(methylamino)-5-thiazoleacetic acid
Description:
4-(4-Methoxyphenyl)-2-(methylamino)-5-thiazoleacetic acid, identified by its CAS number 1019107-99-3, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound is characterized by the presence of a methoxy group and a methylamino group, which contribute to its unique chemical properties and potential biological activity. The thiazoleacetic acid moiety suggests that it may exhibit acidic behavior, likely influencing its solubility and reactivity in various environments. The methoxyphenyl group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics if it is studied for medicinal applications. Overall, the structural features of this compound indicate that it may have interesting interactions in biological systems, making it a candidate for further research in medicinal chemistry or related fields. However, specific properties such as melting point, solubility, and biological activity would require empirical data for comprehensive characterization.
Formula:C13H14N2O3S
InChI:InChI=1S/C13H14N2O3S/c1-14-13-15-12(10(19-13)7-11(16)17)8-3-5-9(18-2)6-4-8/h3-6H,7H2,1-2H3,(H,14,15)(H,16,17)
InChI key:InChIKey=VTNIKEFAYAHXDH-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(N=C(NC)S1)C2=CC=C(OC)C=C2
Synonyms:- 5-Thiazoleacetic acid, 4-(4-methoxyphenyl)-2-(methylamino)-
- 4-(4-Methoxyphenyl)-2-(methylamino)-5-thiazoleacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.