CAS 1019108-38-3
:2-Amino-N-2-propen-1-yl-4-thiazoleacetamide
Description:
2-Amino-N-2-propen-1-yl-4-thiazoleacetamide is a chemical compound characterized by its thiazole and amide functional groups. It features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen, contributing to its unique chemical properties. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The propenyl group suggests that the compound may exhibit reactivity typical of alkenes, potentially allowing for polymerization or addition reactions. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with thiazole derivatives. Its solubility, stability, and reactivity can be influenced by the specific substituents on the thiazole and the amide functional groups. Overall, 2-Amino-N-2-propen-1-yl-4-thiazoleacetamide represents a versatile structure with potential implications in various chemical and biological contexts.
Formula:C8H11N3OS
InChI:InChI=1S/C8H11N3OS/c1-2-3-10-7(12)4-6-5-13-8(9)11-6/h2,5H,1,3-4H2,(H2,9,11)(H,10,12)
InChI key:InChIKey=TVJFQXSLCNEYFH-UHFFFAOYSA-N
SMILES:C(C(NCC=C)=O)C1=CSC(N)=N1
Synonyms:- 4-Thiazoleacetamide, 2-amino-N-2-propen-1-yl-
- 2-Amino-N-2-propen-1-yl-4-thiazoleacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.